CAS 2665660-83-1 is the registry number for 4-Bromo-3-(trifluoromethoxy)pyridine hydrobromide. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
4-bromo-3-(trifluoromethoxy)pyridine;hydrobromide (CAS 2665660-83-1) is a chemical compound with the molecular formula C6H4Br2F3NO and a molecular weight of 322.90 g/mol. IUPAC name: 4-bromo-3-(trifluoromethoxy)pyridine;hydrobromide. InChIKey: SXWKKAITIDDEHT-UHFFFAOYSA-N.
| Molecular formula | C6H4Br2F3NO |
|---|---|
| Molecular weight | 322.90 g/mol |
| IUPAC name | 4-bromo-3-(trifluoromethoxy)pyridine;hydrobromide |
| InChIKey | SXWKKAITIDDEHT-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1Br)OC(F)(F)F.Br |
Computed by PubChem (NCBI)