CAS 2665715-37-5 is the registry number for 3,5-Dibromo-4-((2-(trimethylsilyl)ethoxy)methyl)-4H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,5-dibromo-1,2,4-triazol-4-yl)methoxy]ethyl-trimethylsilane (CAS 2665715-37-5) is a chemical compound with the molecular formula C8H15Br2N3OSi and a molecular weight of 357.12 g/mol. IUPAC name: 2-[(3,5-dibromo-1,2,4-triazol-4-yl)methoxy]ethyl-trimethylsilane. InChIKey: HLEGMFFLYCTWKK-UHFFFAOYSA-N.
| Molecular formula | C8H15Br2N3OSi |
|---|---|
| Molecular weight | 357.12 g/mol |
| IUPAC name | 2-[(3,5-dibromo-1,2,4-triazol-4-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | HLEGMFFLYCTWKK-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C(=NN=C1Br)Br |
Computed by PubChem (NCBI)