CAS 2665768-26-1 appears in our catalog under these names: Poly(9,9-di-(2-ethylhexyl)-fluorenyl-2,7-diyl) end capped with 2,5-diphenyl-1,2,4-oxadiazole, SiCzCz 95%, 9-(3-(Triphenylsilyl)phenyl)-9H-3,9´-bicarbazole, 95%, 95%. Offered by: Lumtec, Ambeed, Chemat. Available pack sizes: On request, 50mg, 1g, 100mg, 250mg.
[3-(3-carbazol-9-ylcarbazol-9-yl)phenyl]-triphenylsilane (CAS 2665768-26-1) is a chemical compound with the molecular formula C48H34N2Si and a molecular weight of 666.9 g/mol. IUPAC name: [3-(3-carbazol-9-ylcarbazol-9-yl)phenyl]-triphenylsilane. InChIKey: STPFPCDLLYBTHV-UHFFFAOYSA-N.
| Molecular formula | C48H34N2Si |
|---|---|
| Molecular weight | 666.9 g/mol |
| IUPAC name | [3-(3-carbazol-9-ylcarbazol-9-yl)phenyl]-triphenylsilane |
| InChIKey | STPFPCDLLYBTHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC(=C4)N5C6=C(C=C(C=C6)N7C8=CC=CC=C8C9=CC=CC=C97)C1=CC=CC=C15 |
Computed by PubChem (NCBI)