CAS 2666-06-0 appears in our catalog under these names: 2,6-Naphthalenedicarboxylic acid dipotassium salt, 95%, Naphthalene–2,6–dicarboxylic Acid Potassium, 2,6-Naphthalenedicarboxylic acid dipotassium salt, 98%, 98%, Dipotassium naphthalene-2,6-dicarboxylate, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 100mg, 250mg, 500mg, 1g, 10g.
Dipotassium;naphthalene-2,6-dicarboxylate (CAS 2666-06-0) is a chemical compound with the molecular formula C12H6K2O4 and a molecular weight of 292.37 g/mol. IUPAC name: dipotassium;naphthalene-2,6-dicarboxylate. InChIKey: QAYXDWGFSMUTBJ-UHFFFAOYSA-L.
| Molecular formula | C12H6K2O4 |
|---|---|
| Molecular weight | 292.37 g/mol |
| IUPAC name | dipotassium;naphthalene-2,6-dicarboxylate |
| InChIKey | QAYXDWGFSMUTBJ-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)[O-])C=C1C(=O)[O-].[K+].[K+] |
Computed by PubChem (NCBI)