CAS 266678-02-8 is the registry number for Genistein 4-Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 25mg.
Sodium [4-(5,7-dihydroxy-4-oxochromen-3-yl)phenyl] sulfate (CAS 266678-02-8) is a chemical compound with the molecular formula C15H9NaO8S and a molecular weight of 372.3 g/mol. IUPAC name: sodium [4-(5,7-dihydroxy-4-oxochromen-3-yl)phenyl] sulfate. InChIKey: WZIPGPWTGCEVCB-UHFFFAOYSA-M.
| Molecular formula | C15H9NaO8S |
|---|---|
| Molecular weight | 372.3 g/mol |
| IUPAC name | sodium [4-(5,7-dihydroxy-4-oxochromen-3-yl)phenyl] sulfate |
| InChIKey | WZIPGPWTGCEVCB-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)