Products 2666994-55-2
CAS 2666994-55-2 is the registry number for 3-Ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97%. Offered by: Chemat. Available pack sizes: 25mg, 50mg.
3-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2666994-55-2) is a chemical compound with the molecular formula C15H20BNO2 and a molecular weight of 257.14 g/mol. IUPAC name: 3-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: FSUIKYQDHHYTOY-UHFFFAOYSA-N.
| Molecular formula | C15H20BNO2 |
|---|---|
| Molecular weight | 257.14 g/mol |
| IUPAC name | 3-ethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | FSUIKYQDHHYTOY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C#N)CC |
Computed by PubChem (NCBI)