CAS 2667554-46-1 is the registry number for 3-(3-Fluoro-4,5-dimethoxyphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-fluoro-4,5-dimethoxyphenyl)-2-oxopropanoic acid (CAS 2667554-46-1) is a chemical compound with the molecular formula C11H11FO5 and a molecular weight of 242.20 g/mol. IUPAC name: 3-(3-fluoro-4,5-dimethoxyphenyl)-2-oxopropanoic acid. InChIKey: IGPUGGMPBYVIQE-UHFFFAOYSA-N.
| Molecular formula | C11H11FO5 |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | 3-(3-fluoro-4,5-dimethoxyphenyl)-2-oxopropanoic acid |
| InChIKey | IGPUGGMPBYVIQE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CC(=O)C(=O)O)F)OC |
Computed by PubChem (NCBI)