CAS 2667597-72-8 appears in our catalog under these names: 4-Bromo-7-fluorobenzo[d][1,3]dioxole-5-carbaldehyde, 98%, 4-Bromo-7-fluorobenzo[d][1,3]dioxole-5-carbaldehyde, 97%, 97%, 4-Bromo-7-fluorobenzo[d][1,3]dioxole-5-carbaldehyde, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
4-bromo-7-fluoro-1,3-benzodioxole-5-carbaldehyde (CAS 2667597-72-8) is a chemical compound with the molecular formula C8H4BrFO3 and a molecular weight of 247.02 g/mol. IUPAC name: 4-bromo-7-fluoro-1,3-benzodioxole-5-carbaldehyde. InChIKey: PRMYGGQIXWHLMI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFO3 |
|---|---|
| Molecular weight | 247.02 g/mol |
| IUPAC name | 4-bromo-7-fluoro-1,3-benzodioxole-5-carbaldehyde |
| InChIKey | PRMYGGQIXWHLMI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(C=C(C(=C2O1)Br)C=O)F |
Computed by PubChem (NCBI)