Products 2667602-26-6
CAS 2667602-26-6 is the registry number for Vamagloxistat (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 4-[4-[4-(3,3-difluorocyclobutyl)phenyl]phenoxy]-1H-triazole-5-carboxylate (CAS 2667602-26-6) is a chemical compound with the molecular formula C19H14F2N3NaO3 and a molecular weight of 393.3 g/mol. IUPAC name: sodium 4-[4-[4-(3,3-difluorocyclobutyl)phenyl]phenoxy]-1H-triazole-5-carboxylate. InChIKey: MUPHWGTXRLARDS-UHFFFAOYSA-M.
| Molecular formula | C19H14F2N3NaO3 |
|---|---|
| Molecular weight | 393.3 g/mol |
| IUPAC name | sodium 4-[4-[4-(3,3-difluorocyclobutyl)phenyl]phenoxy]-1H-triazole-5-carboxylate |
| InChIKey | MUPHWGTXRLARDS-UHFFFAOYSA-M |
| SMILES | C1C(CC1(F)F)C2=CC=C(C=C2)C3=CC=C(C=C3)OC4=C(NN=N4)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)