CAS 266999-20-6 is the registry number for Fmoc-4-((Methylsulfonyl)amino)-DL-phenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(methanesulfonamido)phenyl]propanoic acid (CAS 266999-20-6) is a chemical compound with the molecular formula C25H24N2O6S and a molecular weight of 480.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(methanesulfonamido)phenyl]propanoic acid. InChIKey: XUHUSTBPCQQMFH-UHFFFAOYSA-N.
| Molecular formula | C25H24N2O6S |
|---|---|
| Molecular weight | 480.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(methanesulfonamido)phenyl]propanoic acid |
| InChIKey | XUHUSTBPCQQMFH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)