CAS 267006-26-8 appears in our catalog under these names: Potassium (3,5-difluorophenyl)trifluoroborate 97%, Potassium (3,5-difluorophenyl),trifluoroborate, 97%, 97%, Potassium (3,5-difluorophenyl)trifluoroborate, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g.
Potassium (3,5-difluorophenyl)-trifluoroboranuide (CAS 267006-26-8) is a chemical compound with the molecular formula C6H3BF5K and a molecular weight of 219.99 g/mol. IUPAC name: potassium (3,5-difluorophenyl)-trifluoroboranuide. InChIKey: JFSPHPHYZHGKPO-UHFFFAOYSA-N.
| Molecular formula | C6H3BF5K |
|---|---|
| Molecular weight | 219.99 g/mol |
| IUPAC name | potassium (3,5-difluorophenyl)-trifluoroboranuide |
| InChIKey | JFSPHPHYZHGKPO-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC(=C1)F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)