CAS 267006-27-9 is the registry number for potassium trifluoro(2,4,6-trifluorophenyl)boranuide. Offered by: Chemat. Available pack sizes: 1g, 5g.
Potassium trifluoro-(2,4,6-trifluorophenyl)boranuide (CAS 267006-27-9) is a chemical compound with the molecular formula C6H2BF6K and a molecular weight of 237.98 g/mol. IUPAC name: potassium trifluoro-(2,4,6-trifluorophenyl)boranuide. InChIKey: RHIXZMMFAVUVFY-UHFFFAOYSA-N.
| Molecular formula | C6H2BF6K |
|---|---|
| Molecular weight | 237.98 g/mol |
| IUPAC name | potassium trifluoro-(2,4,6-trifluorophenyl)boranuide |
| InChIKey | RHIXZMMFAVUVFY-UHFFFAOYSA-N |
| SMILES | [B-](C1=C(C=C(C=C1F)F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)