CAS 2672573-05-4 is the registry number for N-Phenyl-4′-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)[1,1′-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-phenyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline (CAS 2672573-05-4) is a chemical compound with the molecular formula C24H26BNO2 and a molecular weight of 371.3 g/mol. IUPAC name: N-phenyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline. InChIKey: JRHZJDIOBVUDLQ-UHFFFAOYSA-N.
| Molecular formula | C24H26BNO2 |
|---|---|
| Molecular weight | 371.3 g/mol |
| IUPAC name | N-phenyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]aniline |
| InChIKey | JRHZJDIOBVUDLQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=C(C=C3)NC4=CC=CC=C4 |
Computed by PubChem (NCBI)