CAS 26727-22-0 appears in our catalog under these names: benzyl 4-aminobutanoate para-toluene sulfonate, 95%, H–γ–Abu–OBzl · p–tosylate, H-GABA-OBzl.TosOH 95%, H-γ-Abu-Obzl.TosOH, 95%, 95%, Benzyl 4-aminobutanoate 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g, 250mg.
Benzyl 4-aminobutanoate;4-methylbenzenesulfonic acid (CAS 26727-22-0) is a chemical compound with the molecular formula C18H23NO5S and a molecular weight of 365.4 g/mol. IUPAC name: benzyl 4-aminobutanoate;4-methylbenzenesulfonic acid. InChIKey: AVEADJJUOBFQIQ-UHFFFAOYSA-N.
| Molecular formula | C18H23NO5S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | benzyl 4-aminobutanoate;4-methylbenzenesulfonic acid |
| InChIKey | AVEADJJUOBFQIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)CCCN |
Computed by PubChem (NCBI)