Products 2673270-00-1
CAS 2673270-00-1 appears in our catalog under these names: D–Panthenol–d4, D-Panthenol-d4, 99.77%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 10 mg, 5 mg.
(2R)-2,4-dihydroxy-3,3-dimethyl-N-(1,1,3,3-tetradeuterio-3-hydroxypropyl)butanamide (CAS 2673270-00-1) is a chemical compound with the molecular formula C9H19NO4 and a molecular weight of 209.28 g/mol. IUPAC name: (2R)-2,4-dihydroxy-3,3-dimethyl-N-(1,1,3,3-tetradeuterio-3-hydroxypropyl)butanamide. InChIKey: SNPLKNRPJHDVJA-LCCDPTQESA-N.
| Molecular formula | C9H19NO4 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-(1,1,3,3-tetradeuterio-3-hydroxypropyl)butanamide |
| InChIKey | SNPLKNRPJHDVJA-LCCDPTQESA-N |
| SMILES | [2H]C([2H])(CC([2H])([2H])O)NC(=O)[C@@H](C(C)(C)CO)O |
Computed by PubChem (NCBI)
Synonyms:
D-Panthenol-d4, D-Panthenol D4