CAS 26733-16-4 is the registry number for (3,5-Dibromo-4-hydroxyphenyl)(phenyl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,5-dibromo-4-hydroxyphenyl)-phenylmethanone (CAS 26733-16-4) is a chemical compound with the molecular formula C13H8Br2O2 and a molecular weight of 356.01 g/mol. IUPAC name: (3,5-dibromo-4-hydroxyphenyl)-phenylmethanone. InChIKey: RUGSIQILWPTQDI-UHFFFAOYSA-N.
| Molecular formula | C13H8Br2O2 |
|---|---|
| Molecular weight | 356.01 g/mol |
| IUPAC name | (3,5-dibromo-4-hydroxyphenyl)-phenylmethanone |
| InChIKey | RUGSIQILWPTQDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C(=C2)Br)O)Br |
Computed by PubChem (NCBI)