Products 26733-18-6
CAS 26733-18-6 is the registry number for (4-amino-3,5-dibromophenyl)(phenyl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(4-amino-3,5-dibromophenyl)-phenylmethanone (CAS 26733-18-6) is a chemical compound with the molecular formula C13H9Br2NO and a molecular weight of 355.02 g/mol. IUPAC name: (4-amino-3,5-dibromophenyl)-phenylmethanone. InChIKey: ROOYXYKMLWEXIU-UHFFFAOYSA-N.
| Molecular formula | C13H9Br2NO |
|---|---|
| Molecular weight | 355.02 g/mol |
| IUPAC name | (4-amino-3,5-dibromophenyl)-phenylmethanone |
| InChIKey | ROOYXYKMLWEXIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C(=C2)Br)N)Br |
Computed by PubChem (NCBI)