CAS 26737-71-3 is the registry number for 2-(tert-Butylamino)-4-chloro-6-cyclopropylamino-1,3,5-triazine. Offered by: TRC. Available pack sizes: 500mg, 5g.
2-N-tert-butyl-6-chloro-4-N-cyclopropyl-1,3,5-triazine-2,4-diamine (CAS 26737-71-3) is a chemical compound with the molecular formula C10H16ClN5 and a molecular weight of 241.72 g/mol. IUPAC name: 2-N-tert-butyl-6-chloro-4-N-cyclopropyl-1,3,5-triazine-2,4-diamine. InChIKey: FHDFJPIRJCWFNA-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN5 |
|---|---|
| Molecular weight | 241.72 g/mol |
| IUPAC name | 2-N-tert-butyl-6-chloro-4-N-cyclopropyl-1,3,5-triazine-2,4-diamine |
| InChIKey | FHDFJPIRJCWFNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=NC(=NC(=N1)NC2CC2)Cl |
Computed by PubChem (NCBI)