Products 2674058-66-1
CAS 2674058-66-1 is the registry number for SelB-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-methoxyphenyl)-[3,4,5-tris(4-hydroxyphenyl)phenyl]methanone (CAS 2674058-66-1) is a chemical compound with the molecular formula C32H24O5 and a molecular weight of 488.5 g/mol. IUPAC name: (4-methoxyphenyl)-[3,4,5-tris(4-hydroxyphenyl)phenyl]methanone. InChIKey: OGYSXDLCKNVOTE-UHFFFAOYSA-N.
| Molecular formula | C32H24O5 |
|---|---|
| Molecular weight | 488.5 g/mol |
| IUPAC name | (4-methoxyphenyl)-[3,4,5-tris(4-hydroxyphenyl)phenyl]methanone |
| InChIKey | OGYSXDLCKNVOTE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC(=C(C(=C2)C3=CC=C(C=C3)O)C4=CC=C(C=C4)O)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)