Products 2674101-37-0
CAS 2674101-37-0 is the registry number for Mito-PN. Offered by: MedChemExpress. Available pack sizes: Get quote.
2'-amino-10-(diethylamino)-3-hydroxyspiro[benzo[c]xanthene-7,3'-isoindole]-1'-one (CAS 2674101-37-0) is a chemical compound with the molecular formula C28H25N3O3 and a molecular weight of 451.5 g/mol. IUPAC name: 2'-amino-10-(diethylamino)-3-hydroxyspiro[benzo[c]xanthene-7,3'-isoindole]-1'-one. InChIKey: KQVGJTDXRCWPQQ-UHFFFAOYSA-N.
| Molecular formula | C28H25N3O3 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | 2'-amino-10-(diethylamino)-3-hydroxyspiro[benzo[c]xanthene-7,3'-isoindole]-1'-one |
| InChIKey | KQVGJTDXRCWPQQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C5=C(C=C4)C=C(C=C5)O)C6=CC=CC=C6C(=O)N3N |
Computed by PubChem (NCBI)
Synonyms:
Mito-PN, orb3134235