Products 2674205-02-6
CAS 2674205-02-6 is the registry number for 8,9–Dihydrocannabidivarin. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol (CAS 2674205-02-6) is a chemical compound with the molecular formula C19H28O2 and a molecular weight of 288.4 g/mol. IUPAC name: 2-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol. InChIKey: YOJPFISTURZHJT-JKSUJKDBSA-N.
| Molecular formula | C19H28O2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 2-[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-5-propylbenzene-1,3-diol |
| InChIKey | YOJPFISTURZHJT-JKSUJKDBSA-N |
| SMILES | CCCC1=CC(=C(C(=C1)O)[C@@H]2C=C(CC[C@H]2C(C)C)C)O |
Computed by PubChem (NCBI)