CAS 793-55-5 appears in our catalog under these names: Levonorgestrel EP Impurity K, Levonorgestrel Impurity 11(Levonorgestrel EP Impurity K), 18-Methyl Nandrolone, >95% (HPLC), 18-Methyl Nandrolone (1.0mg/ml in Acetonitrile), 18-Methyl Nandrolone. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10x1ml, 2mg.
(8R,9S,10R,13S,14S,17S)-13-ethyl-17-hydroxy-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (CAS 793-55-5) is a chemical compound with the molecular formula C19H28O2 and a molecular weight of 288.4 g/mol. IUPAC name: (8R,9S,10R,13S,14S,17S)-13-ethyl-17-hydroxy-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one. InChIKey: FBYZQDCRLYHHHP-ZOFHRBRSSA-N.
| Molecular formula | C19H28O2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S,17S)-13-ethyl-17-hydroxy-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| InChIKey | FBYZQDCRLYHHHP-ZOFHRBRSSA-N |
| SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)CC[C@H]34 |
Computed by PubChem (NCBI)