Products 26747-90-0
CAS 26747-90-0 appears in our catalog under these names: 2,4-TDI dimer, 1,3-Bis(3-isocyanatomethylphenyl)-1,3-diazetidine-2,4-dione, >95%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 100mg, 250mg, 1g.
1,3-bis(3-isocyanato-4-methylphenyl)-1,3-diazetidine-2,4-dione (CAS 26747-90-0) is a chemical compound with the molecular formula C18H12N4O4 and a molecular weight of 348.3 g/mol. IUPAC name: 1,3-bis(3-isocyanato-4-methylphenyl)-1,3-diazetidine-2,4-dione. InChIKey: LOCPTSFJZDIICR-UHFFFAOYSA-N.
| Molecular formula | C18H12N4O4 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 1,3-bis(3-isocyanato-4-methylphenyl)-1,3-diazetidine-2,4-dione |
| InChIKey | LOCPTSFJZDIICR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)N(C2=O)C3=CC(=C(C=C3)C)N=C=O)N=C=O |
Computed by PubChem (NCBI)