CAS 26750-50-5 appears in our catalog under these names: Bis(vinylsulfonylmethyl) ether, 98%, Bis(vinylsulfonylmethyl) Ether. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 1g, 2,5g, 250mg, 500mg.
1-(ethenylsulfonylmethoxymethylsulfonyl)ethene (CAS 26750-50-5) is a chemical compound with the molecular formula C6H10O5S2 and a molecular weight of 226.3 g/mol. IUPAC name: 1-(ethenylsulfonylmethoxymethylsulfonyl)ethene. InChIKey: KAMCBFNNGGVPPW-UHFFFAOYSA-N.
| Molecular formula | C6H10O5S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 1-(ethenylsulfonylmethoxymethylsulfonyl)ethene |
| InChIKey | KAMCBFNNGGVPPW-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)COCS(=O)(=O)C=C |
Computed by PubChem (NCBI)