Products 2675491-15-1
CAS 2675491-15-1 is the registry number for (2,6-Dipivalamidopyridin-3-yl)boronic acid, 95%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
[2,6-bis(2,2-dimethylpropanoylamino)-3-pyridinyl]boronic acid (CAS 2675491-15-1) is a chemical compound with the molecular formula C15H24BN3O4 and a molecular weight of 321.18 g/mol. IUPAC name: [2,6-bis(2,2-dimethylpropanoylamino)-3-pyridinyl]boronic acid. InChIKey: XNDACFNVZZZLQL-UHFFFAOYSA-N.
| Molecular formula | C15H24BN3O4 |
|---|---|
| Molecular weight | 321.18 g/mol |
| IUPAC name | [2,6-bis(2,2-dimethylpropanoylamino)-3-pyridinyl]boronic acid |
| InChIKey | XNDACFNVZZZLQL-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)NC(=O)C(C)(C)C)NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)