Products 2676155-98-7
CAS 2676155-98-7 is the registry number for EGFR-IN-71. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-chloro-3-ethynylphenyl)-7-iodoquinazolin-4-amine (CAS 2676155-98-7) is a chemical compound with the molecular formula C16H9ClIN3 and a molecular weight of 405.62 g/mol. IUPAC name: N-(4-chloro-3-ethynylphenyl)-7-iodoquinazolin-4-amine. InChIKey: NLIGPBIDARIYKE-UHFFFAOYSA-N.
| Molecular formula | C16H9ClIN3 |
|---|---|
| Molecular weight | 405.62 g/mol |
| IUPAC name | N-(4-chloro-3-ethynylphenyl)-7-iodoquinazolin-4-amine |
| InChIKey | NLIGPBIDARIYKE-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C=CC(=C1)NC2=NC=NC3=C2C=CC(=C3)I)Cl |
Computed by PubChem (NCBI)