Products 2676172-20-4

CAS 2676172-20-4 is the registry number for 4-Hydroxy-bis(2,6-diisopropylphenyl)imidazolium bromide. Offered by: Chemat Brand. Available pack sizes: 1g, 5g, 10g, 50g.

Structural formula: {0} (CAS {1})

1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-ol bromide (CAS 2676172-20-4) is a chemical compound with the molecular formula C27H37BrN2O and a molecular weight of 485.5 g/mol. IUPAC name: 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-ol bromide. InChIKey: ALKWIWDCJOJPIX-UHFFFAOYSA-N.

Identity
Molecular formulaC27H37BrN2O
Molecular weight485.5 g/mol
IUPAC name1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-ol bromide
InChIKeyALKWIWDCJOJPIX-UHFFFAOYSA-N
SMILESCC(C)C1=C(C(=CC=C1)C(C)C)N2C=[N+](C=C2O)C3=C(C=CC=C3C(C)C)C(C)C.[Br-]

Computed by PubChem (NCBI)