CAS 2676172-20-4 is the registry number for 4-Hydroxy-bis(2,6-diisopropylphenyl)imidazolium bromide. Offered by: Chemat Brand. Available pack sizes: 1g, 5g, 10g, 50g.
1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-ol bromide (CAS 2676172-20-4) is a chemical compound with the molecular formula C27H37BrN2O and a molecular weight of 485.5 g/mol. IUPAC name: 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-ol bromide. InChIKey: ALKWIWDCJOJPIX-UHFFFAOYSA-N.
| Molecular formula | C27H37BrN2O |
|---|---|
| Molecular weight | 485.5 g/mol |
| IUPAC name | 1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium-4-ol bromide |
| InChIKey | ALKWIWDCJOJPIX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N2C=[N+](C=C2O)C3=C(C=CC=C3C(C)C)C(C)C.[Br-] |
Computed by PubChem (NCBI)