CAS 2676188-98-8 is the registry number for D228, 99.77%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg, 100 mg.
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methyl-4-oxo-5-propan-2-ylidenefuran-3-yl)oxyoxan-2-yl]methyl acetate (CAS 2676188-98-8) is a chemical compound with the molecular formula C22H28O12 and a molecular weight of 484.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methyl-4-oxo-5-propan-2-ylidenefuran-3-yl)oxyoxan-2-yl]methyl acetate. InChIKey: GLNKLSQINQQSFI-JLMLEOCNSA-N.
| Molecular formula | C22H28O12 |
|---|---|
| Molecular weight | 484.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-methyl-4-oxo-5-propan-2-ylidenefuran-3-yl)oxyoxan-2-yl]methyl acetate |
| InChIKey | GLNKLSQINQQSFI-JLMLEOCNSA-N |
| SMILES | CC1=C(C(=O)C(=C(C)C)O1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)