CAS 267659-71-2 appears in our catalog under these names: 1-((4-Trifluoromethoxy)phenyl) piperazin-2-one hydrochloride, 95%, 1-(4-(Trifluoromethoxy)phenyl)piperazin-2-one hydrochloride 95%, 1-(4-(Trifluoromethoxy)phenyl)piperazin-2-one hydrochloride, 95%, 95%, 1-(4-(Trifluoromethoxy)phenyl)piperazin-2-one hydrochloride, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-[4-(trifluoromethoxy)phenyl]piperazin-2-one;hydrochloride (CAS 267659-71-2) is a chemical compound with the molecular formula C11H12ClF3N2O2 and a molecular weight of 296.67 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]piperazin-2-one;hydrochloride. InChIKey: HKEVKJNOHPGMOQ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF3N2O2 |
|---|---|
| Molecular weight | 296.67 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]piperazin-2-one;hydrochloride |
| InChIKey | HKEVKJNOHPGMOQ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC=C(C=C2)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)