CAS 26766-37-0 is the registry number for LY56110. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[bis(4-chlorophenyl)methyl]pyrimidine (CAS 26766-37-0) is a chemical compound with the molecular formula C17H12Cl2N2 and a molecular weight of 315.2 g/mol. IUPAC name: 5-[bis(4-chlorophenyl)methyl]pyrimidine. InChIKey: FOQIAMHLCXUKND-UHFFFAOYSA-N.
| Molecular formula | C17H12Cl2N2 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | 5-[bis(4-chlorophenyl)methyl]pyrimidine |
| InChIKey | FOQIAMHLCXUKND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)C3=CN=CN=C3)Cl |
Computed by PubChem (NCBI)