Products 267667-78-7

CAS 267667-78-7 appears in our catalog under these names: 1,1-Dioxo-2,5-dihydro-1lambda6-thiophene-3-carboxylic acid, 95%, 2,5-Dihydrothiophene-3-carboxylic acid 1,1-dioxide, 95%, 3-Sulfolene-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1,1-dioxo-2,5-dihydrothiophene-3-carboxylic acid (CAS 267667-78-7) is a chemical compound with the molecular formula C5H6O4S and a molecular weight of 162.17 g/mol. IUPAC name: 1,1-dioxo-2,5-dihydrothiophene-3-carboxylic acid. InChIKey: GSPYMZGNJJKNFW-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6O4S
Molecular weight162.17 g/mol
IUPAC name1,1-dioxo-2,5-dihydrothiophene-3-carboxylic acid
InChIKeyGSPYMZGNJJKNFW-UHFFFAOYSA-N
SMILESC1C=C(CS1(=O)=O)C(=O)O

Computed by PubChem (NCBI)