CAS 2677762-43-3 appears in our catalog under these names: HIV–1 inhibitor–45, HIV-1 inhibitor-45, 99%, 99%, HIV-1 inhibitor-45, 99.54%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 10 mg, 10mM/1mL, 25 mg.
4-(4-aminophenyl)sulfonyl-N-(furan-2-ylmethyl)-1-(3,4,5-trihydroxybenzoyl)piperazine-2-carboxamide (CAS 2677762-43-3) is a chemical compound with the molecular formula C23H24N4O8S and a molecular weight of 516.5 g/mol. IUPAC name: 4-(4-aminophenyl)sulfonyl-N-(furan-2-ylmethyl)-1-(3,4,5-trihydroxybenzoyl)piperazine-2-carboxamide. InChIKey: RBSXWZYRKATMTP-UHFFFAOYSA-N.
| Molecular formula | C23H24N4O8S |
|---|---|
| Molecular weight | 516.5 g/mol |
| IUPAC name | 4-(4-aminophenyl)sulfonyl-N-(furan-2-ylmethyl)-1-(3,4,5-trihydroxybenzoyl)piperazine-2-carboxamide |
| InChIKey | RBSXWZYRKATMTP-UHFFFAOYSA-N |
| SMILES | C1CN(C(CN1S(=O)(=O)C2=CC=C(C=C2)N)C(=O)NCC3=CC=CO3)C(=O)C4=CC(=C(C(=C4)O)O)O |
Computed by PubChem (NCBI)