CAS 26798-52-7 appears in our catalog under these names: (H–Gly–Cys–OH)₂, (H-Gly-Cys-OH)2 (Disulfide bond). Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg.
(2R)-2-[(2-aminoacetyl)amino]-3-[[(2R)-2-[(2-aminoacetyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid (CAS 26798-52-7) is a chemical compound with the molecular formula C10H18N4O6S2 and a molecular weight of 354.4 g/mol. IUPAC name: (2R)-2-[(2-aminoacetyl)amino]-3-[[(2R)-2-[(2-aminoacetyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid. InChIKey: FHEXRJMTJAKHSB-WDSKDSINSA-N.
| Molecular formula | C10H18N4O6S2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2R)-2-[(2-aminoacetyl)amino]-3-[[(2R)-2-[(2-aminoacetyl)amino]-2-carboxyethyl]disulfanyl]propanoic acid |
| InChIKey | FHEXRJMTJAKHSB-WDSKDSINSA-N |
| SMILES | C([C@@H](C(=O)O)NC(=O)CN)SSC[C@@H](C(=O)O)NC(=O)CN |
Computed by PubChem (NCBI)