CAS 2679940-23-7 is the registry number for Benzyl (S)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 2679940-23-7) is a chemical compound with the molecular formula C13H15F2NO3 and a molecular weight of 271.26 g/mol. IUPAC name: benzyl (2S)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: YQMBOEZEGTXNTQ-NSHDSACASA-N.
| Molecular formula | C13H15F2NO3 |
|---|---|
| Molecular weight | 271.26 g/mol |
| IUPAC name | benzyl (2S)-4,4-difluoro-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | YQMBOEZEGTXNTQ-NSHDSACASA-N |
| SMILES | C1[C@H](N(CC1(F)F)C(=O)OCC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)