CAS 2679950-66-2 is the registry number for (3AS,6aS)-3a-(hydroxymethyl)-6a-methyltetrahydro-1H,3H-thieno[3,4-c]furan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3aS,6aS)-6a-(hydroxymethyl)-3a-methyl-4,6-dihydro-1H-thieno[3,4-c]furan-3-one (CAS 2679950-66-2) is a chemical compound with the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. IUPAC name: (3aS,6aS)-6a-(hydroxymethyl)-3a-methyl-4,6-dihydro-1H-thieno[3,4-c]furan-3-one. InChIKey: FXUWICNLCLRJNG-HTQZYQBOSA-N.
| Molecular formula | C8H12O3S |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | (3aS,6aS)-6a-(hydroxymethyl)-3a-methyl-4,6-dihydro-1H-thieno[3,4-c]furan-3-one |
| InChIKey | FXUWICNLCLRJNG-HTQZYQBOSA-N |
| SMILES | C[C@]12CSC[C@]1(COC2=O)CO |
Computed by PubChem (NCBI)