CAS 2680531-51-3 is the registry number for Lithium 3-hydroxyoxetane-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Lithium 3-hydroxyoxetane-3-carboxylate (CAS 2680531-51-3) is a chemical compound with the molecular formula C4H5LiO4 and a molecular weight of 124.0 g/mol. IUPAC name: lithium 3-hydroxyoxetane-3-carboxylate. InChIKey: OOBQPHRKARDMLK-UHFFFAOYSA-M.
| Molecular formula | C4H5LiO4 |
|---|---|
| Molecular weight | 124.0 g/mol |
| IUPAC name | lithium 3-hydroxyoxetane-3-carboxylate |
| InChIKey | OOBQPHRKARDMLK-UHFFFAOYSA-M |
| SMILES | [Li+].C1C(CO1)(C(=O)[O-])O |
Computed by PubChem (NCBI)