CAS 2680577-10-8 appears in our catalog under these names: 1-(1,4-Diethoxy-1,4-dioxobutan-2-yl)pyridin-1-ium ethyl sulfate, 98%, 98%, 1-(1,4-Diethoxy-1,4-dioxobutan-2-yl)pyridin-1-ium ethyl sulfate, 98%, 1-(1,4-Diethoxy-1,4-dioxobutan-2-yl)pyridin-1-ium ethyl sulfate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g.
Diethyl 2-pyridin-1-ium-1-ylbutanedioate;ethyl sulfate (CAS 2680577-10-8) is a chemical compound with the molecular formula C15H23NO8S and a molecular weight of 377.4 g/mol. IUPAC name: diethyl 2-pyridin-1-ium-1-ylbutanedioate;ethyl sulfate. InChIKey: JGDQCSOLUUJYHI-UHFFFAOYSA-M.
| Molecular formula | C15H23NO8S |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | diethyl 2-pyridin-1-ium-1-ylbutanedioate;ethyl sulfate |
| InChIKey | JGDQCSOLUUJYHI-UHFFFAOYSA-M |
| SMILES | CCOC(=O)CC(C(=O)OCC)[N+]1=CC=CC=C1.CCOS(=O)(=O)[O-] |
Computed by PubChem (NCBI)