CAS 2681-00-7 is the registry number for 3,3,4,4,5,5,6,6-Octafluoro-1,8-diiodooctane, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3,3,4,4,5,5,6,6-octafluoro-1,8-diiodooctane (CAS 2681-00-7) is a chemical compound with the molecular formula C8H8F8I2 and a molecular weight of 509.94 g/mol. IUPAC name: 3,3,4,4,5,5,6,6-octafluoro-1,8-diiodooctane. InChIKey: IGGDHHHKQANRAY-UHFFFAOYSA-N.
| Molecular formula | C8H8F8I2 |
|---|---|
| Molecular weight | 509.94 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6-octafluoro-1,8-diiodooctane |
| InChIKey | IGGDHHHKQANRAY-UHFFFAOYSA-N |
| SMILES | C(CI)C(C(C(C(CCI)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)