CAS 2681-45-0 is the registry number for 5beta-Androsterone Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 500mg.
CAS 2681-45-0 identifies a chemical compound with the molecular formula C19H30NaO5S and a molecular weight of 393.5 g/mol. InChIKey: FIQFEPBTTJDSMK-DXUXAWASSA-N.
| Molecular formula | C19H30NaO5S |
|---|---|
| Molecular weight | 393.5 g/mol |
| InChIKey | FIQFEPBTTJDSMK-DXUXAWASSA-N |
| SMILES | C[C@]12CC[C@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)OS(=O)(=O)O.[Na] |
Computed by PubChem (NCBI)