CAS 22229-22-7 appears in our catalog under these names: Epiandrosterone Sulfate Sodium Salt (1.0 mg/ml in Methanol), Epiandrosterone sulfate sodium. Offered by: TRC, Biosynth. Available pack sizes: 10x1ml, 50mg, 25mg, 100mg, 500mg, 250mg.
CAS 22229-22-7 identifies a chemical compound with the molecular formula C19H30NaO5S and a molecular weight of 393.5 g/mol. InChIKey: FIQFEPBTTJDSMK-RAINVEOOSA-N.
| Molecular formula | C19H30NaO5S |
|---|---|
| Molecular weight | 393.5 g/mol |
| InChIKey | FIQFEPBTTJDSMK-RAINVEOOSA-N |
| SMILES | C[C@]12CC[C@@H](C[C@@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)OS(=O)(=O)O.[Na] |
Computed by PubChem (NCBI)