CAS 2681390-66-7 is the registry number for 4-(Aminomethyl)-N,N-dimethyl-1H-pyrazole-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(aminomethyl)-N,N-dimethylpyrazole-1-sulfonamide (CAS 2681390-66-7) is a chemical compound with the molecular formula C6H12N4O2S and a molecular weight of 204.25 g/mol. IUPAC name: 4-(aminomethyl)-N,N-dimethylpyrazole-1-sulfonamide. InChIKey: SUMSPIUSTZYZTI-UHFFFAOYSA-N.
| Molecular formula | C6H12N4O2S |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 4-(aminomethyl)-N,N-dimethylpyrazole-1-sulfonamide |
| InChIKey | SUMSPIUSTZYZTI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C=C(C=N1)CN |
Computed by PubChem (NCBI)