CAS 2681395-24-2 is the registry number for 3-Bromo-5,7-dichloro-6-methoxypyrazolo[1,5-a]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5,7-dichloro-6-methoxypyrazolo[1,5-a]pyrimidine (CAS 2681395-24-2) is a chemical compound with the molecular formula C7H4BrCl2N3O and a molecular weight of 296.93 g/mol. IUPAC name: 3-bromo-5,7-dichloro-6-methoxypyrazolo[1,5-a]pyrimidine. InChIKey: PKIJXNYVBPULAY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2N3O |
|---|---|
| Molecular weight | 296.93 g/mol |
| IUPAC name | 3-bromo-5,7-dichloro-6-methoxypyrazolo[1,5-a]pyrimidine |
| InChIKey | PKIJXNYVBPULAY-UHFFFAOYSA-N |
| SMILES | COC1=C(N2C(=C(C=N2)Br)N=C1Cl)Cl |
Computed by PubChem (NCBI)