Products 2682112-95-2
CAS 2682112-95-2 is the registry number for 5,5-Dimethyl-2,6-diazaspiro[3.4]octan-7-one 4-methylbenzenesulfonate, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5,5-dimethyl-2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid (CAS 2682112-95-2) is a chemical compound with the molecular formula C15H22N2O4S and a molecular weight of 326.4 g/mol. IUPAC name: 5,5-dimethyl-2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid. InChIKey: HOCYWWCUGKJLPX-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 5,5-dimethyl-2,6-diazaspiro[3.4]octan-7-one;4-methylbenzenesulfonic acid |
| InChIKey | HOCYWWCUGKJLPX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1(C2(CC(=O)N1)CNC2)C |
Computed by PubChem (NCBI)