Products 26839-77-0
CAS 26839-77-0 appears in our catalog under these names: Timolol EP Impurity A Maleate ((R)-Timolol Maleate), D–Timolol maleate, (R)-(+)-Timolol maleate, (+)-3-(3-tert-Butylamino-2-hydroxypropoxy)-4-morpholino-1,2,5-thiadiazole hydrogen maleate, 95%, 95%. Offered by: Chemat Brand, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 1mg, 25mg, 5mg, 500mg, 50mg.
(Z)-but-2-enedioic acid;(2R)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol (CAS 26839-77-0) is a chemical compound with the molecular formula C17H28N4O7S and a molecular weight of 432.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;(2R)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol. InChIKey: WLRMANUAADYWEA-ASSQPYIHSA-N.
| Molecular formula | C17H28N4O7S |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;(2R)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol |
| InChIKey | WLRMANUAADYWEA-ASSQPYIHSA-N |
| SMILES | CC(C)(C)NC[C@H](COC1=NSN=C1N2CCOCC2)O.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)