CAS 2684278-41-7 is the registry number for 1,5-Bis(7-hydroxynaphthalen-1-yl)penta-1,4-dien-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1E,4E)-1,5-bis(7-hydroxynaphthalen-1-yl)penta-1,4-dien-3-one (CAS 2684278-41-7) is a chemical compound with the molecular formula C25H18O3 and a molecular weight of 366.4 g/mol. IUPAC name: (1E,4E)-1,5-bis(7-hydroxynaphthalen-1-yl)penta-1,4-dien-3-one. InChIKey: DEGVVYVDQBLILS-MKICQXMISA-N.
| Molecular formula | C25H18O3 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (1E,4E)-1,5-bis(7-hydroxynaphthalen-1-yl)penta-1,4-dien-3-one |
| InChIKey | DEGVVYVDQBLILS-MKICQXMISA-N |
| SMILES | C1=CC2=C(C(=C1)/C=C/C(=O)/C=C/C3=CC=CC4=C3C=C(C=C4)O)C=C(C=C2)O |
Computed by PubChem (NCBI)