CAS 268539-19-1 appears in our catalog under these names: Tris-succinimidyl-1,3,5-benzenetricarboxylate, 95%, TRIS-SUCCINIMIDYL-1,3,5-BENZENETRICARBOXYLATE, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tris(2,5-dioxopyrrolidin-1-yl) benzene-1,3,5-tricarboxylate (CAS 268539-19-1) is a chemical compound with the molecular formula C21H15N3O12 and a molecular weight of 501.4 g/mol. IUPAC name: tris(2,5-dioxopyrrolidin-1-yl) benzene-1,3,5-tricarboxylate. InChIKey: BCFNKSPKXMSVLG-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O12 |
|---|---|
| Molecular weight | 501.4 g/mol |
| IUPAC name | tris(2,5-dioxopyrrolidin-1-yl) benzene-1,3,5-tricarboxylate |
| InChIKey | BCFNKSPKXMSVLG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC(=CC(=C2)C(=O)ON3C(=O)CCC3=O)C(=O)ON4C(=O)CCC4=O |
Computed by PubChem (NCBI)