Products 268563-94-6
CAS 268563-94-6 is the registry number for 5,6-dimethoxy-2-((3-phenoxyphenyl)methylene)indan-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
(2E)-5,6-dimethoxy-2-[(3-phenoxyphenyl)methylidene]-3H-inden-1-one (CAS 268563-94-6) is a chemical compound with the molecular formula C24H20O4 and a molecular weight of 372.4 g/mol. IUPAC name: (2E)-5,6-dimethoxy-2-[(3-phenoxyphenyl)methylidene]-3H-inden-1-one. InChIKey: SFALPUXWEDISBQ-WOJGMQOQSA-N.
| Molecular formula | C24H20O4 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (2E)-5,6-dimethoxy-2-[(3-phenoxyphenyl)methylidene]-3H-inden-1-one |
| InChIKey | SFALPUXWEDISBQ-WOJGMQOQSA-N |
| SMILES | COC1=C(C=C2C(=C1)C/C(=C\C3=CC(=CC=C3)OC4=CC=CC=C4)/C2=O)OC |
Computed by PubChem (NCBI)