Products 2687265-18-3
CAS 2687265-18-3 is the registry number for Anticancer agent 42. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,6-dichloro-3-(2-methyl-1H-indol-3-yl)-5-morpholin-4-ylcyclohexa-2,5-diene-1,4-dione (CAS 2687265-18-3) is a chemical compound with the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.2 g/mol. IUPAC name: 2,6-dichloro-3-(2-methyl-1H-indol-3-yl)-5-morpholin-4-ylcyclohexa-2,5-diene-1,4-dione. InChIKey: QGROEQOAPSQCOH-UHFFFAOYSA-N.
| Molecular formula | C19H16Cl2N2O3 |
|---|---|
| Molecular weight | 391.2 g/mol |
| IUPAC name | 2,6-dichloro-3-(2-methyl-1H-indol-3-yl)-5-morpholin-4-ylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | QGROEQOAPSQCOH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C3=C(C(=O)C(=C(C3=O)N4CCOCC4)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 42, orb1688261