CAS 268733-63-7 appears in our catalog under these names: Fmoc-d-9-anthrylalanine, 95%, Fmoc-D-9-Anthrylalanine, 98%, 98%, FMOC-3-(9-ANTHRYL)-D-ALANINE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
(2R)-3-anthracen-9-yl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 268733-63-7) is a chemical compound with the molecular formula C32H25NO4 and a molecular weight of 487.5 g/mol. IUPAC name: (2R)-3-anthracen-9-yl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: OGLRHZZGDZRSHK-SSEXGKCCSA-N.
| Molecular formula | C32H25NO4 |
|---|---|
| Molecular weight | 487.5 g/mol |
| IUPAC name | (2R)-3-anthracen-9-yl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | OGLRHZZGDZRSHK-SSEXGKCCSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)