CAS 26883-29-4 appears in our catalog under these names: Methyl 3-methyl-1-oxidopyridin-4-yl ether, 4-Methoxy-3-methylpyridine 1-oxide 95% (hydrate), Methyl 3-methyl-1-oxidopyridin-4-yl ether, 98%, Methyl 3-methyl-1-oxidopyridin-4-yl ether, 95% (hydrate), 95% (hydrate). Offered by: Biosynth, Ambeed, Combi-blocks, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 10g, 25g.
4-methoxy-3-methyl-1-oxidopyridin-1-ium (CAS 26883-29-4) is a chemical compound with the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. IUPAC name: 4-methoxy-3-methyl-1-oxidopyridin-1-ium. InChIKey: BTHHSVRNEVRRCX-UHFFFAOYSA-N.
| Molecular formula | C7H9NO2 |
|---|---|
| Molecular weight | 139.15 g/mol |
| IUPAC name | 4-methoxy-3-methyl-1-oxidopyridin-1-ium |
| InChIKey | BTHHSVRNEVRRCX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1)[O-])OC |
Computed by PubChem (NCBI)